C17H22O7 — CID 101158839
diethyl 2-[(S)-1,3-dioxolan-2-yl(phenyl)methyl]-2-hydroxypropanedioate (PubChem CID 101158839) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is diethyl 2-[(S)-1,3-dioxolan-2-yl(phenyl)methyl]-2-hydroxypropanedioate.
| Compound Name | diethyl 2-[(S)-1,3-dioxolan-2-yl(phenyl)methyl]-2-hydroxypropanedioate |
|---|---|
| PubChem CID | 101158839 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | diethyl 2-[(S)-1,3-dioxolan-2-yl(phenyl)methyl]-2-hydroxypropanedioate |
| SMILES | CCOC(=O)C(O)(C(=O)OCC)[C@H](c1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C17H22O7/c1-3-21-15(18)17(20,16(19)22-4-2)13(14-23-10-11-24-14)12-8-6-5-7-9-12/h5-9,13-14,20H,3-4,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | GMSOLOZUFLNPAV-CYBMUJFWSA-N |
| XLogP | 1.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|