C22H28O4 — CID 141498905
3-(3-hydroxybutan-2-yloxy)butan-2-yl 2,2-diphenylacetate (PubChem CID 141498905) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(3-hydroxybutan-2-yloxy)butan-2-yl 2,2-diphenylacetate.
| Compound Name | 3-(3-hydroxybutan-2-yloxy)butan-2-yl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 141498905 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(3-hydroxybutan-2-yloxy)butan-2-yl 2,2-diphenylacetate |
| SMILES | CC(O)C(C)OC(C)C(C)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O4/c1-15(23)16(2)25-17(3)18(4)26-22(24)21(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18,21,23H,1-4H3 |
| InChIKey | XEWBGJRDYVRUEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |