tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate

C56H44O8Sn — CID 141350105

IUPACtris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate
SMILESO=C(O[Sn](OC(=O)C(c1ccccc1)c1ccccc1)(OC(=O)C(c1ccccc1)c1ccccc1)OC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1
InChIInChI=1S/4C14H12O2.Sn/c4*15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h4*1-10,13H,(H,15,16);/q;;;;+4/p-4
InChIKeyAZCBFDXZXSMARJ-UHFFFAOYSA-J
MW963.67 g/mol
LogP10.92
Rot. Bonds16

About tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate

tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate (PubChem CID 141350105) has the molecular formula C56H44O8Sn and a molecular weight of 963.67 g/mol. Its IUPAC name is tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate.

Molecular Properties

Compound Nametris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate
PubChem CID141350105
Molecular FormulaC56H44O8Sn
Molecular Weight963.67 g/mol
Exact Mass964.21
IUPAC Nametris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate
SMILESO=C(O[Sn](OC(=O)C(c1ccccc1)c1ccccc1)(OC(=O)C(c1ccccc1)c1ccccc1)OC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1
InChIInChI=1S/4C14H12O2.Sn/c4*15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h4*1-10,13H,(H,15,16);/q;;;;+4/p-4
InChIKeyAZCBFDXZXSMARJ-UHFFFAOYSA-J
XLogP10.92
TPSA105.20 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds16
Heavy Atoms65
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500963.67
LogP ≤ 510.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate?
The IUPAC name of tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate (CID 141350105) is tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate.
What is the SMILES notation for tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate?
The canonical SMILES for tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate is O=C(O[Sn](OC(=O)C(c1ccccc1)c1ccccc1)(OC(=O)C(c1ccccc1)c1ccccc1)OC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate?
The InChIKey is AZCBFDXZXSMARJ-UHFFFAOYSA-J. The full InChI is InChI=1S/4C14H12O2.Sn/c4*15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h4*1-10,13H,(H,15,16);/q;;;;+4/p-4.
What are the key properties of tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate?
tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate has a molecular weight of 963.67 g/mol, XLogP of 10.92, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate is sourced from PubChem (CID 141350105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).