C56H44O8Sn — CID 141350105
tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate (PubChem CID 141350105) has the molecular formula C56H44O8Sn and a molecular weight of 963.67 g/mol. Its IUPAC name is tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate.
| Compound Name | tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 141350105 |
| Molecular Formula | C56H44O8Sn |
| Molecular Weight | 963.67 g/mol |
| Exact Mass | 964.21 |
| IUPAC Name | tris[(2,2-diphenylacetyl)oxy]stannyl 2,2-diphenylacetate |
| SMILES | O=C(O[Sn](OC(=O)C(c1ccccc1)c1ccccc1)(OC(=O)C(c1ccccc1)c1ccccc1)OC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/4C14H12O2.Sn/c4*15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h4*1-10,13H,(H,15,16);/q;;;;+4/p-4 |
| InChIKey | AZCBFDXZXSMARJ-UHFFFAOYSA-J |
| XLogP | 10.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.67 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |