C16H14Cl3O5P — CID 154418136
[2,2,2-trichloro-1-(2,2-diphenylacetyl)oxyethyl]phosphonic acid (PubChem CID 154418136) has the molecular formula C16H14Cl3O5P and a molecular weight of 423.62 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(2,2-diphenylacetyl)oxyethyl]phosphonic acid.
| Compound Name | [2,2,2-trichloro-1-(2,2-diphenylacetyl)oxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 154418136 |
| Molecular Formula | C16H14Cl3O5P |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | [2,2,2-trichloro-1-(2,2-diphenylacetyl)oxyethyl]phosphonic acid |
| SMILES | O=C(OC(C(Cl)(Cl)Cl)P(=O)(O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl3O5P/c17-16(18,19)15(25(21,22)23)24-14(20)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,15H,(H2,21,22,23) |
| InChIKey | WHKQTLFBTKRPMH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|