C18H13F7O2 — CID 4086856
2,2,3,3,4,4,4-heptafluorobutyl 2,2-diphenylacetate (PubChem CID 4086856) has the molecular formula C18H13F7O2 and a molecular weight of 394.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2,2-diphenylacetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 4086856 |
| Molecular Formula | C18H13F7O2 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2,2-diphenylacetate |
| SMILES | O=C(OCC(F)(F)C(F)(F)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13F7O2/c19-16(20,17(21,22)18(23,24)25)11-27-15(26)14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | MMATXRQKBXKUDZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|