C14H11F7O4 — CID 101257070
2,2,3,3,4,4,4-heptafluorobutyl 2-acetyloxy-2-phenylacetate (PubChem CID 101257070) has the molecular formula C14H11F7O4 and a molecular weight of 376.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-acetyloxy-2-phenylacetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 101257070 |
| Molecular Formula | C14H11F7O4 |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-acetyloxy-2-phenylacetate |
| SMILES | CC(=O)OC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H11F7O4/c1-8(22)25-10(9-5-3-2-4-6-9)11(23)24-7-12(15,16)13(17,18)14(19,20)21/h2-6,10H,7H2,1H3 |
| InChIKey | TUEYSCRYNOEOBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|