C23H13F15O4 — CID 101257055
[2-oxo-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)-1-phenylethyl] benzoate (PubChem CID 101257055) has the molecular formula C23H13F15O4 and a molecular weight of 638.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)-1-phenylethyl] benzoate.
| Compound Name | [2-oxo-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)-1-phenylethyl] benzoate |
|---|---|
| PubChem CID | 101257055 |
| Molecular Formula | C23H13F15O4 |
| Molecular Weight | 638.32 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | [2-oxo-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)-1-phenylethyl] benzoate |
| SMILES | O=C(OC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H13F15O4/c24-17(25,18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)38)11-41-16(40)14(12-7-3-1-4-8-12)42-15(39)13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | CPPXIIPLFRPICC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.32 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|