C15H11F11O3 — CID 156765834
methyl 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptyl)benzoate (PubChem CID 156765834) has the molecular formula C15H11F11O3 and a molecular weight of 448.23 g/mol. Its IUPAC name is methyl 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptyl)benzoate.
| Compound Name | methyl 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptyl)benzoate |
|---|---|
| PubChem CID | 156765834 |
| Molecular Formula | C15H11F11O3 |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | methyl 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoro-1-hydroxyheptyl)benzoate |
| SMILES | COC(=O)c1cccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F11O3/c1-29-10(28)8-4-2-3-7(5-8)9(27)6-11(16,17)12(18,19)13(20,21)14(22,23)15(24,25)26/h2-5,9,27H,6H2,1H3 |
| InChIKey | QBEJWTLZURQKPA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|