C29H26F6O9 — CID 158368038
methyl 3-formylbenzoate;bis(methyl 3-(2,2,2-trifluoro-1-hydroxyethyl)benzoate) (PubChem CID 158368038) has the molecular formula C29H26F6O9 and a molecular weight of 632.51 g/mol. Its IUPAC name is methyl 3-formylbenzoate;bis(methyl 3-(2,2,2-trifluoro-1-hydroxyethyl)benzoate).
| Compound Name | methyl 3-formylbenzoate;bis(methyl 3-(2,2,2-trifluoro-1-hydroxyethyl)benzoate) |
|---|---|
| PubChem CID | 158368038 |
| Molecular Formula | C29H26F6O9 |
| Molecular Weight | 632.51 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | methyl 3-formylbenzoate;bis(methyl 3-(2,2,2-trifluoro-1-hydroxyethyl)benzoate) |
| SMILES | COC(=O)c1cccc(C(O)C(F)(F)F)c1.COC(=O)c1cccc(C(O)C(F)(F)F)c1.COC(=O)c1cccc(C=O)c1 |
| InChI | InChI=1S/2C10H9F3O3.C9H8O3/c2*1-16-9(15)7-4-2-3-6(5-7)8(14)10(11,12)13;1-12-9(11)8-4-2-3-7(5-8)6-10/h2*2-5,8,14H,1H3;2-6H,1H3 |
| InChIKey | GUGQUZHGODWLDF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|