C10H8BrF3O3 — CID 58188392
methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate (PubChem CID 58188392) has the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. Its IUPAC name is methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate.
| Compound Name | methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate |
|---|---|
| PubChem CID | 58188392 |
| Molecular Formula | C10H8BrF3O3 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate |
| SMILES | COC(=O)c1cc(Br)cc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8BrF3O3/c1-17-9(16)6-2-5(3-7(11)4-6)8(15)10(12,13)14/h2-4,8,15H,1H3 |
| InChIKey | WERJNASZZDDLEL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |