methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate

C10H8BrF3O3 — CID 58188392

IUPACmethyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate
SMILESCOC(=O)c1cc(Br)cc(C(O)C(F)(F)F)c1
InChIInChI=1S/C10H8BrF3O3/c1-17-9(16)6-2-5(3-7(11)4-6)8(15)10(12,13)14/h2-4,8,15H,1H3
InChIKeyWERJNASZZDDLEL-UHFFFAOYSA-N
MW313.07 g/mol
LogP2.83
Rot. Bonds2

About methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate

methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate (PubChem CID 58188392) has the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. Its IUPAC name is methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate
PubChem CID58188392
Molecular FormulaC10H8BrF3O3
Molecular Weight313.07 g/mol
Exact Mass311.96
IUPAC Namemethyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate
SMILESCOC(=O)c1cc(Br)cc(C(O)C(F)(F)F)c1
InChIInChI=1S/C10H8BrF3O3/c1-17-9(16)6-2-5(3-7(11)4-6)8(15)10(12,13)14/h2-4,8,15H,1H3
InChIKeyWERJNASZZDDLEL-UHFFFAOYSA-N
XLogP2.83
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.07
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate?
The IUPAC name of methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate (CID 58188392) is methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate.
What is the SMILES notation for methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate?
The canonical SMILES for methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate is COC(=O)c1cc(Br)cc(C(O)C(F)(F)F)c1.
What is the InChIKey of methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate?
The InChIKey is WERJNASZZDDLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF3O3/c1-17-9(16)6-2-5(3-7(11)4-6)8(15)10(12,13)14/h2-4,8,15H,1H3.
What are the key properties of methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate?
methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate has a molecular weight of 313.07 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-5-(2,2,2-trifluoro-1-hydroxyethyl)benzoate is sourced from PubChem (CID 58188392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).