methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate

C16H9Br2F3O3 — CID 142587698

IUPACmethyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate
SMILESCOC(=O)c1cc(Br)cc(C(=O)c2cc(Br)cc(C(F)(F)F)c2)c1
InChIInChI=1S/C16H9Br2F3O3/c1-24-15(23)10-2-8(4-12(17)6-10)14(22)9-3-11(16(19,20)21)7-13(18)5-9/h2-7H,1H3
InChIKeyDJGNICGQUHOEAO-UHFFFAOYSA-N
MW466.05 g/mol
LogP5.25
Rot. Bonds3

About methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate

methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate (PubChem CID 142587698) has the molecular formula C16H9Br2F3O3 and a molecular weight of 466.05 g/mol. Its IUPAC name is methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate
PubChem CID142587698
Molecular FormulaC16H9Br2F3O3
Molecular Weight466.05 g/mol
Exact Mass463.89
IUPAC Namemethyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate
SMILESCOC(=O)c1cc(Br)cc(C(=O)c2cc(Br)cc(C(F)(F)F)c2)c1
InChIInChI=1S/C16H9Br2F3O3/c1-24-15(23)10-2-8(4-12(17)6-10)14(22)9-3-11(16(19,20)21)7-13(18)5-9/h2-7H,1H3
InChIKeyDJGNICGQUHOEAO-UHFFFAOYSA-N
XLogP5.25
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500466.05
LogP ≤ 55.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate?
The IUPAC name of methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate (CID 142587698) is methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate.
What is the SMILES notation for methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate?
The canonical SMILES for methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate is COC(=O)c1cc(Br)cc(C(=O)c2cc(Br)cc(C(F)(F)F)c2)c1.
What is the InChIKey of methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate?
The InChIKey is DJGNICGQUHOEAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Br2F3O3/c1-24-15(23)10-2-8(4-12(17)6-10)14(22)9-3-11(16(19,20)21)7-13(18)5-9/h2-7H,1H3.
What are the key properties of methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate?
methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate has a molecular weight of 466.05 g/mol, XLogP of 5.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-5-[3-bromo-5-(trifluoromethyl)benzoyl]benzoate is sourced from PubChem (CID 142587698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).