C9H7BrF3NO3 — CID 174346926
methyl N-[3-bromo-5-(trifluoromethyl)phenoxy]carbamate (PubChem CID 174346926) has the molecular formula C9H7BrF3NO3 and a molecular weight of 314.06 g/mol. Its IUPAC name is methyl N-[3-bromo-5-(trifluoromethyl)phenoxy]carbamate.
| Compound Name | methyl N-[3-bromo-5-(trifluoromethyl)phenoxy]carbamate |
|---|---|
| PubChem CID | 174346926 |
| Molecular Formula | C9H7BrF3NO3 |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | methyl N-[3-bromo-5-(trifluoromethyl)phenoxy]carbamate |
| SMILES | COC(=O)NOc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7BrF3NO3/c1-16-8(15)14-17-7-3-5(9(11,12)13)2-6(10)4-7/h2-4H,1H3,(H,14,15) |
| InChIKey | OXUVZOFEHIYOAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|