C14H16BrF3N2O4 — CID 146184889
ethyl 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methylpropanoate (PubChem CID 146184889) has the molecular formula C14H16BrF3N2O4 and a molecular weight of 413.19 g/mol. Its IUPAC name is ethyl 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 146184889 |
| Molecular Formula | C14H16BrF3N2O4 |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | ethyl 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NC(=O)NOc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16BrF3N2O4/c1-4-23-11(21)13(2,3)19-12(22)20-24-10-6-8(14(16,17)18)5-9(15)7-10/h5-7H,4H2,1-3H3,(H2,19,20,22) |
| InChIKey | QOGNUNHIBXSLQN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|