C14H14BrF6N3O3 — CID 146172293
2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 146172293) has the molecular formula C14H14BrF6N3O3 and a molecular weight of 466.18 g/mol. Its IUPAC name is 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 146172293 |
| Molecular Formula | C14H14BrF6N3O3 |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 2-[[3-bromo-5-(trifluoromethyl)phenoxy]carbamoylamino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)(NC(=O)NOc1cc(Br)cc(C(F)(F)F)c1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H14BrF6N3O3/c1-12(2,10(25)22-6-13(16,17)18)23-11(26)24-27-9-4-7(14(19,20)21)3-8(15)5-9/h3-5H,6H2,1-2H3,(H,22,25)(H2,23,24,26) |
| InChIKey | QKOXWVOKCXTAMH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|