C17H13BrF6O2 — CID 160510157
1-bromo-3-methyl-5-(trifluoromethyl)benzene;3-methyl-5-(trifluoromethyl)benzoic acid (PubChem CID 160510157) has the molecular formula C17H13BrF6O2 and a molecular weight of 443.18 g/mol. Its IUPAC name is 1-bromo-3-methyl-5-(trifluoromethyl)benzene;3-methyl-5-(trifluoromethyl)benzoic acid.
| Compound Name | 1-bromo-3-methyl-5-(trifluoromethyl)benzene;3-methyl-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 160510157 |
| Molecular Formula | C17H13BrF6O2 |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 1-bromo-3-methyl-5-(trifluoromethyl)benzene;3-methyl-5-(trifluoromethyl)benzoic acid |
| SMILES | Cc1cc(Br)cc(C(F)(F)F)c1.Cc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O2.C8H6BrF3/c1-5-2-6(8(13)14)4-7(3-5)9(10,11)12;1-5-2-6(8(10,11)12)4-7(9)3-5/h2-4H,1H3,(H,13,14);2-4H,1H3 |
| InChIKey | QSYCQQVZMRXDMK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |