C12H11F3O — CID 168950566
cyclopropyl-[3-methyl-5-(trifluoromethyl)phenyl]methanone (PubChem CID 168950566) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is cyclopropyl-[3-methyl-5-(trifluoromethyl)phenyl]methanone.
| Compound Name | cyclopropyl-[3-methyl-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 168950566 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | cyclopropyl-[3-methyl-5-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1cc(C(=O)C2CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O/c1-7-4-9(11(16)8-2-3-8)6-10(5-7)12(13,14)15/h4-6,8H,2-3H2,1H3 |
| InChIKey | YWQQIHRFSZJEFO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |