C18H16F6O3 — CID 158005309
3-methyl-5-(trifluoromethyl)benzoic acid;[3-methyl-5-(trifluoromethyl)phenyl]methanol (PubChem CID 158005309) has the molecular formula C18H16F6O3 and a molecular weight of 394.31 g/mol. Its IUPAC name is 3-methyl-5-(trifluoromethyl)benzoic acid;[3-methyl-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | 3-methyl-5-(trifluoromethyl)benzoic acid;[3-methyl-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 158005309 |
| Molecular Formula | C18H16F6O3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-methyl-5-(trifluoromethyl)benzoic acid;[3-methyl-5-(trifluoromethyl)phenyl]methanol |
| SMILES | Cc1cc(C(=O)O)cc(C(F)(F)F)c1.Cc1cc(CO)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O2.C9H9F3O/c1-5-2-6(8(13)14)4-7(3-5)9(10,11)12;1-6-2-7(5-13)4-8(3-6)9(10,11)12/h2-4H,1H3,(H,13,14);2-4,13H,5H2,1H3 |
| InChIKey | FEFIUSJCLOOHKU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |