C15H20F3NO3 — CID 162089686
[3-methyl-5-(trifluoromethyl)phenyl]methanol;piperidine-1-carboxylic acid (PubChem CID 162089686) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethyl)phenyl]methanol;piperidine-1-carboxylic acid.
| Compound Name | [3-methyl-5-(trifluoromethyl)phenyl]methanol;piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 162089686 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [3-methyl-5-(trifluoromethyl)phenyl]methanol;piperidine-1-carboxylic acid |
| SMILES | Cc1cc(CO)cc(C(F)(F)F)c1.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C9H9F3O.C6H11NO2/c1-6-2-7(5-13)4-8(3-6)9(10,11)12;8-6(9)7-4-2-1-3-5-7/h2-4,13H,5H2,1H3;1-5H2,(H,8,9) |
| InChIKey | ZDKYDXNMDGOWLE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |