C14H15F4NO2 — CID 66720623
[3-fluoro-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate (PubChem CID 66720623) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is [3-fluoro-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate.
| Compound Name | [3-fluoro-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66720623 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [3-fluoro-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate |
| SMILES | O=C(OCc1cc(F)cc(C(F)(F)F)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H15F4NO2/c15-12-7-10(6-11(8-12)14(16,17)18)9-21-13(20)19-4-2-1-3-5-19/h6-8H,1-5,9H2 |
| InChIKey | QDODRSRQIXLQJM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |