C15H15F3N2O2 — CID 150200523
[3-cyano-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate (PubChem CID 150200523) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is [3-cyano-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate.
| Compound Name | [3-cyano-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 150200523 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [3-cyano-5-(trifluoromethyl)phenyl]methyl piperidine-1-carboxylate |
| SMILES | N#Cc1cc(COC(=O)N2CCCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)13-7-11(9-19)6-12(8-13)10-22-14(21)20-4-2-1-3-5-20/h6-8H,1-5,10H2 |
| InChIKey | FPJMYJMLWJILDX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |