C18H17F6N5O3 — CID 137119340
[3,5-bis(trifluoromethyl)phenyl]methyl 2-(N'-hydroxycarbamimidoyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 137119340) has the molecular formula C18H17F6N5O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl 2-(N'-hydroxycarbamimidoyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-(N'-hydroxycarbamimidoyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 137119340 |
| Molecular Formula | C18H17F6N5O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-(N'-hydroxycarbamimidoyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | NC(=NO)c1cc2n(n1)CCCN(C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C18H17F6N5O3/c19-17(20,21)11-4-10(5-12(6-11)18(22,23)24)9-32-16(30)28-2-1-3-29-13(8-28)7-14(26-29)15(25)27-31/h4-7,31H,1-3,8-9H2,(H2,25,27) |
| InChIKey | AJKFNDBMZXNINX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|