C20H22F6N4O2 — CID 140700504
[3,5-bis(trifluoromethyl)phenyl]methyl 2-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 140700504) has the molecular formula C20H22F6N4O2 and a molecular weight of 464.41 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 140700504 |
| Molecular Formula | C20H22F6N4O2 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(dimethylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | CN(C)Cc1cc2n(n1)CCCN(C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C20H22F6N4O2/c1-28(2)10-16-9-17-11-29(4-3-5-30(17)27-16)18(31)32-12-13-6-14(19(21,22)23)8-15(7-13)20(24,25)26/h6-9H,3-5,10-12H2,1-2H3 |
| InChIKey | YFFBHSAZAYLRPZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |