C24H27F6N5O3 — CID 140700395
[3,5-bis(trifluoromethyl)phenyl]methyl 2-[(2R,6R)-2,6-dimethylpiperazine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 140700395) has the molecular formula C24H27F6N5O3 and a molecular weight of 547.50 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(2R,6R)-2,6-dimethylpiperazine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(2R,6R)-2,6-dimethylpiperazine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 140700395 |
| Molecular Formula | C24H27F6N5O3 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl 2-[(2R,6R)-2,6-dimethylpiperazine-1-carbonyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | C[C@@H]1CNC[C@@H](C)N1C(=O)c1cc2n(n1)CCCN(C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C24H27F6N5O3/c1-14-10-31-11-15(2)35(14)21(36)20-9-19-12-33(4-3-5-34(19)32-20)22(37)38-13-16-6-17(23(25,26)27)8-18(7-16)24(28,29)30/h6-9,14-15,31H,3-5,10-13H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | ZBELBLHCKYWECR-HUUCEWRRSA-N |
| XLogP | 4.29 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |