C18H16ClF6N3O3 — CID 90460595
[3-chloro-5-(trifluoromethyl)phenyl]methyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 90460595) has the molecular formula C18H16ClF6N3O3 and a molecular weight of 471.79 g/mol. Its IUPAC name is [3-chloro-5-(trifluoromethyl)phenyl]methyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | [3-chloro-5-(trifluoromethyl)phenyl]methyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 90460595 |
| Molecular Formula | C18H16ClF6N3O3 |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | [3-chloro-5-(trifluoromethyl)phenyl]methyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(C(F)(F)F)c1)N1CCCn2nc(C(O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C18H16ClF6N3O3/c19-12-5-10(4-11(6-12)17(20,21)22)9-31-16(30)27-2-1-3-28-13(8-27)7-14(26-28)15(29)18(23,24)25/h4-7,15,29H,1-3,8-9H2 |
| InChIKey | LHCYKPHNZIFYQK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |