About (4-aminophenyl)methyl piperidine-1-carboxylate
(4-aminophenyl)methyl piperidine-1-carboxylate (PubChem CID 67586124) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-aminophenyl)methyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-aminophenyl)methyl piperidine-1-carboxylate |
| PubChem CID | 67586124 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4-aminophenyl)methyl piperidine-1-carboxylate |
| SMILES | Nc1ccc(COC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C13H18N2O2/c14-12-6-4-11(5-7-12)10-17-13(16)15-8-2-1-3-9-15/h4-7H,1-3,8-10,14H2 |
| InChIKey | LAURHFOSBLHGPG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)methyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)methyl piperidine-1-carboxylate?
The IUPAC name of (4-aminophenyl)methyl piperidine-1-carboxylate (CID 67586124) is (4-aminophenyl)methyl piperidine-1-carboxylate.
What is the SMILES notation for (4-aminophenyl)methyl piperidine-1-carboxylate?
The canonical SMILES for (4-aminophenyl)methyl piperidine-1-carboxylate is Nc1ccc(COC(=O)N2CCCCC2)cc1.
What is the InChIKey of (4-aminophenyl)methyl piperidine-1-carboxylate?
The InChIKey is LAURHFOSBLHGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c14-12-6-4-11(5-7-12)10-17-13(16)15-8-2-1-3-9-15/h4-7H,1-3,8-10,14H2.
What are the key properties of (4-aminophenyl)methyl piperidine-1-carboxylate?
(4-aminophenyl)methyl piperidine-1-carboxylate has a molecular weight of 234.30 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)methyl piperidine-1-carboxylate is sourced from PubChem (CID 67586124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).