C14H15ClF3NO3 — CID 66720549
[3-chloro-4-(trifluoromethoxy)phenyl]methyl piperidine-1-carboxylate (PubChem CID 66720549) has the molecular formula C14H15ClF3NO3 and a molecular weight of 337.73 g/mol. Its IUPAC name is [3-chloro-4-(trifluoromethoxy)phenyl]methyl piperidine-1-carboxylate.
| Compound Name | [3-chloro-4-(trifluoromethoxy)phenyl]methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66720549 |
| Molecular Formula | C14H15ClF3NO3 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [3-chloro-4-(trifluoromethoxy)phenyl]methyl piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccc(OC(F)(F)F)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H15ClF3NO3/c15-11-8-10(4-5-12(11)22-14(16,17)18)9-21-13(20)19-6-2-1-3-7-19/h4-5,8H,1-3,6-7,9H2 |
| InChIKey | WTZSEWUPOTWAND-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |