C10H9ClF3NO3 — CID 174912242
amino 3-[3-chloro-4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 174912242) has the molecular formula C10H9ClF3NO3 and a molecular weight of 283.63 g/mol. Its IUPAC name is amino 3-[3-chloro-4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | amino 3-[3-chloro-4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 174912242 |
| Molecular Formula | C10H9ClF3NO3 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | amino 3-[3-chloro-4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | NOC(=O)CCc1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClF3NO3/c11-7-5-6(2-4-9(16)18-15)1-3-8(7)17-10(12,13)14/h1,3,5H,2,4,15H2 |
| InChIKey | LCJKUWCIHKPUQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|