C10H12Cl2F3NO2 — CID 170892599
2-amino-3-[3-chloro-4-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride (PubChem CID 170892599) has the molecular formula C10H12Cl2F3NO2 and a molecular weight of 306.11 g/mol. Its IUPAC name is 2-amino-3-[3-chloro-4-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[3-chloro-4-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170892599 |
| Molecular Formula | C10H12Cl2F3NO2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-amino-3-[3-chloro-4-(trifluoromethoxy)phenyl]propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClF3NO2.ClH/c11-8-4-6(3-7(15)5-16)1-2-9(8)17-10(12,13)14;/h1-2,4,7,16H,3,5,15H2;1H |
| InChIKey | CFNXMPNAASRGHI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |