C10H10Cl2F3NO2 — CID 170893686
2-amino-3-[2,6-dichloro-4-(trifluoromethoxy)phenyl]propan-1-ol (PubChem CID 170893686) has the molecular formula C10H10Cl2F3NO2 and a molecular weight of 304.10 g/mol. Its IUPAC name is 2-amino-3-[2,6-dichloro-4-(trifluoromethoxy)phenyl]propan-1-ol.
| Compound Name | 2-amino-3-[2,6-dichloro-4-(trifluoromethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 170893686 |
| Molecular Formula | C10H10Cl2F3NO2 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 2-amino-3-[2,6-dichloro-4-(trifluoromethoxy)phenyl]propan-1-ol |
| SMILES | NC(CO)Cc1c(Cl)cc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2F3NO2/c11-8-2-6(18-10(13,14)15)3-9(12)7(8)1-5(16)4-17/h2-3,5,17H,1,4,16H2 |
| InChIKey | KFEAKIVUEJCREO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |