C7H6ClF3N2O — CID 118807866
3-chloro-5-(trifluoromethoxy)benzene-1,2-diamine (PubChem CID 118807866) has the molecular formula C7H6ClF3N2O and a molecular weight of 226.59 g/mol. Its IUPAC name is 3-chloro-5-(trifluoromethoxy)benzene-1,2-diamine.
| Compound Name | 3-chloro-5-(trifluoromethoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 118807866 |
| Molecular Formula | C7H6ClF3N2O |
| Molecular Weight | 226.59 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 3-chloro-5-(trifluoromethoxy)benzene-1,2-diamine |
| SMILES | Nc1cc(OC(F)(F)F)cc(Cl)c1N |
| InChI | InChI=1S/C7H6ClF3N2O/c8-4-1-3(14-7(9,10)11)2-5(12)6(4)13/h1-2H,12-13H2 |
| InChIKey | XJGNPXXQMIKELE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|