C7H2BCl2F7N2O — CID 87286976
2,6-dichloro-4-(trifluoromethoxy)benzenediazonium tetrafluoroborate (PubChem CID 87286976) has the molecular formula C7H2BCl2F7N2O and a molecular weight of 344.81 g/mol. Its IUPAC name is 2,6-dichloro-4-(trifluoromethoxy)benzenediazonium tetrafluoroborate.
| Compound Name | 2,6-dichloro-4-(trifluoromethoxy)benzenediazonium tetrafluoroborate |
|---|---|
| PubChem CID | 87286976 |
| Molecular Formula | C7H2BCl2F7N2O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 2,6-dichloro-4-(trifluoromethoxy)benzenediazonium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]c1c(Cl)cc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C7H2Cl2F3N2O.BF4/c8-4-1-3(15-7(10,11)12)2-5(9)6(4)14-13;2-1(3,4)5/h1-2H;/q+1;-1 |
| InChIKey | LYZBTRQPUGLOPZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|