C13H8Cl2F3NO2 — CID 90344335
2,6-dichloro-4-[4-(trifluoromethoxy)phenoxy]aniline (PubChem CID 90344335) has the molecular formula C13H8Cl2F3NO2 and a molecular weight of 338.11 g/mol. Its IUPAC name is 2,6-dichloro-4-[4-(trifluoromethoxy)phenoxy]aniline.
| Compound Name | 2,6-dichloro-4-[4-(trifluoromethoxy)phenoxy]aniline |
|---|---|
| PubChem CID | 90344335 |
| Molecular Formula | C13H8Cl2F3NO2 |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2,6-dichloro-4-[4-(trifluoromethoxy)phenoxy]aniline |
| SMILES | Nc1c(Cl)cc(Oc2ccc(OC(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C13H8Cl2F3NO2/c14-10-5-9(6-11(15)12(10)19)20-7-1-3-8(4-2-7)21-13(16,17)18/h1-6H,19H2 |
| InChIKey | SNLRTVJBIPVQGP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|