C14H8ClF6NO2 — CID 87205815
4-[2-chloro-4-(trifluoromethoxy)phenoxy]-3-(trifluoromethyl)aniline (PubChem CID 87205815) has the molecular formula C14H8ClF6NO2 and a molecular weight of 371.66 g/mol. Its IUPAC name is 4-[2-chloro-4-(trifluoromethoxy)phenoxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[2-chloro-4-(trifluoromethoxy)phenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 87205815 |
| Molecular Formula | C14H8ClF6NO2 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 4-[2-chloro-4-(trifluoromethoxy)phenoxy]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(OC(F)(F)F)cc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8ClF6NO2/c15-10-6-8(24-14(19,20)21)2-4-12(10)23-11-3-1-7(22)5-9(11)13(16,17)18/h1-6H,22H2 |
| InChIKey | GUPAKIVOISLHGQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|