C53H34F12N4O7 — CID 141458746
bis[4-[3,5-bis[4-amino-2-(trifluoromethyl)phenoxy]phenoxy]phenyl]methanone (PubChem CID 141458746) has the molecular formula C53H34F12N4O7 and a molecular weight of 1066.85 g/mol. Its IUPAC name is bis[4-[3,5-bis[4-amino-2-(trifluoromethyl)phenoxy]phenoxy]phenyl]methanone.
| Compound Name | bis[4-[3,5-bis[4-amino-2-(trifluoromethyl)phenoxy]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 141458746 |
| Molecular Formula | C53H34F12N4O7 |
| Molecular Weight | 1066.85 g/mol |
| Exact Mass | 1066.22 |
| IUPAC Name | bis[4-[3,5-bis[4-amino-2-(trifluoromethyl)phenoxy]phenoxy]phenyl]methanone |
| SMILES | Nc1ccc(Oc2cc(Oc3ccc(C(=O)c4ccc(Oc5cc(Oc6ccc(N)cc6C(F)(F)F)cc(Oc6ccc(N)cc6C(F)(F)F)c5)cc4)cc3)cc(Oc3ccc(N)cc3C(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C53H34F12N4O7/c54-50(55,56)41-17-29(66)5-13-45(41)73-37-21-35(22-38(25-37)74-46-14-6-30(67)18-42(46)51(57,58)59)71-33-9-1-27(2-10-33)49(70)28-3-11-34(12-4-28)72-36-23-39(75-47-15-7-31(68)19-43(47)52(60,61)62)26-40(24-36)76-48-16-8-32(69)20-44(48)53(63,64)65/h1-26H,66-69H2 |
| InChIKey | VGXSLWKWWOYQGQ-UHFFFAOYSA-N |
| XLogP | 16.08 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.85 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|