C26H22F3N3O — CID 175585193
9H-fluorene-2,7-diamine;4-phenoxy-3-(trifluoromethyl)aniline (PubChem CID 175585193) has the molecular formula C26H22F3N3O and a molecular weight of 449.48 g/mol. Its IUPAC name is 9H-fluorene-2,7-diamine;4-phenoxy-3-(trifluoromethyl)aniline.
| Compound Name | 9H-fluorene-2,7-diamine;4-phenoxy-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 175585193 |
| Molecular Formula | C26H22F3N3O |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 9H-fluorene-2,7-diamine;4-phenoxy-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccccc2)c(C(F)(F)F)c1.Nc1ccc2c(c1)Cc1cc(N)ccc1-2 |
| InChI | InChI=1S/C13H10F3NO.C13H12N2/c14-13(15,16)11-8-9(17)6-7-12(11)18-10-4-2-1-3-5-10;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-8H,17H2;1-4,6-7H,5,14-15H2 |
| InChIKey | APYQLFYFCAATHD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|