About 9H-fluoren-2-amine;hydrobromide
9H-fluoren-2-amine;hydrobromide (PubChem CID 141482724) has the molecular formula C13H12BrN
and a molecular weight of 262.15 g/mol. Its IUPAC name is 9H-fluoren-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 9H-fluoren-2-amine;hydrobromide |
| PubChem CID | 141482724 |
| Molecular Formula | C13H12BrN |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 9H-fluoren-2-amine;hydrobromide |
| SMILES | Br.Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H11N.BrH/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;/h1-6,8H,7,14H2;1H |
| InChIKey | WDVMDSNYCITFQU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-2-amine;hydrobromide?
The IUPAC name of 9H-fluoren-2-amine;hydrobromide (CID 141482724) is 9H-fluoren-2-amine;hydrobromide.
What is the SMILES notation for 9H-fluoren-2-amine;hydrobromide?
The canonical SMILES for 9H-fluoren-2-amine;hydrobromide is Br.Nc1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluoren-2-amine;hydrobromide?
The InChIKey is WDVMDSNYCITFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N.BrH/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;/h1-6,8H,7,14H2;1H.
What are the key properties of 9H-fluoren-2-amine;hydrobromide?
9H-fluoren-2-amine;hydrobromide has a molecular weight of 262.15 g/mol, XLogP of 3.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-2-amine;hydrobromide is sourced from PubChem (CID 141482724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).