C13H16Cl4N2 — CID 140751459
9H-fluorene-2,7-diamine;tetrahydrochloride (PubChem CID 140751459) has the molecular formula C13H16Cl4N2 and a molecular weight of 342.10 g/mol. Its IUPAC name is 9H-fluorene-2,7-diamine;tetrahydrochloride.
| Compound Name | 9H-fluorene-2,7-diamine;tetrahydrochloride |
|---|---|
| PubChem CID | 140751459 |
| Molecular Formula | C13H16Cl4N2 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 9H-fluorene-2,7-diamine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Nc1ccc2c(c1)Cc1cc(N)ccc1-2 |
| InChI | InChI=1S/C13H12N2.4ClH/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12;;;;/h1-4,6-7H,5,14-15H2;4*1H |
| InChIKey | SOJJEMIVIGGQFA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|