C8H10ClN — CID 91844882
bicyclo[4.2.0]octa-1(6),2,4-trien-3-amine;hydrochloride (PubChem CID 91844882) has the molecular formula C8H10ClN and a molecular weight of 155.63 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1(6),2,4-trien-3-amine;hydrochloride.
| Compound Name | bicyclo[4.2.0]octa-1(6),2,4-trien-3-amine;hydrochloride |
|---|---|
| PubChem CID | 91844882 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | bicyclo[4.2.0]octa-1(6),2,4-trien-3-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C8H9N.ClH/c9-8-4-3-6-1-2-7(6)5-8;/h3-5H,1-2,9H2;1H |
| InChIKey | LHUAGIGSYLCNAS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|