About 3-phenylaniline
3-phenylaniline (PubChem CID 16717) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-phenylaniline.
Molecular Properties
| Compound Name | 3-phenylaniline |
| PubChem CID | 16717 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-phenylaniline |
| SMILES | Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H11N/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,13H2 |
| InChIKey | MUNOBADFTHUUFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylaniline?
The IUPAC name of 3-phenylaniline (CID 16717) is 3-phenylaniline.
What is the SMILES notation for 3-phenylaniline?
The canonical SMILES for 3-phenylaniline is Nc1cccc(-c2ccccc2)c1.
What is the InChIKey of 3-phenylaniline?
The InChIKey is MUNOBADFTHUUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,13H2.
What are the key properties of 3-phenylaniline?
3-phenylaniline has a molecular weight of 169.23 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylaniline is sourced from PubChem (CID 16717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).