C13H11IN2 — CID 163741687
2-N-iodo-9H-fluorene-2,7-diamine (PubChem CID 163741687) has the molecular formula C13H11IN2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-N-iodo-9H-fluorene-2,7-diamine.
| Compound Name | 2-N-iodo-9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 163741687 |
| Molecular Formula | C13H11IN2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-N-iodo-9H-fluorene-2,7-diamine |
| SMILES | Nc1ccc2c(c1)Cc1cc(NI)ccc1-2 |
| InChI | InChI=1S/C13H11IN2/c14-16-11-2-4-13-9(7-11)5-8-6-10(15)1-3-12(8)13/h1-4,6-7,16H,5,15H2 |
| InChIKey | LIIFOJVMZSDSGN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|