C14H11ClF6N2O — CID 22906581
4-[4-amino-2-(trifluoromethyl)phenoxy]-3-(trifluoromethyl)aniline;hydrochloride (PubChem CID 22906581) has the molecular formula C14H11ClF6N2O and a molecular weight of 372.70 g/mol. Its IUPAC name is 4-[4-amino-2-(trifluoromethyl)phenoxy]-3-(trifluoromethyl)aniline;hydrochloride.
| Compound Name | 4-[4-amino-2-(trifluoromethyl)phenoxy]-3-(trifluoromethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 22906581 |
| Molecular Formula | C14H11ClF6N2O |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-[4-amino-2-(trifluoromethyl)phenoxy]-3-(trifluoromethyl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(Oc2ccc(N)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6N2O.ClH/c15-13(16,17)9-5-7(21)1-3-11(9)23-12-4-2-8(22)6-10(12)14(18,19)20;/h1-6H,21-22H2;1H |
| InChIKey | PNHTZOAUASCDDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|