C12H8F4N2O — CID 61389468
4-[(5-fluoro-2-pyridinyl)oxy]-3-(trifluoromethyl)aniline (PubChem CID 61389468) has the molecular formula C12H8F4N2O and a molecular weight of 272.20 g/mol. Its IUPAC name is 4-[(5-fluoro-2-pyridinyl)oxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[(5-fluoro-2-pyridinyl)oxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 61389468 |
| Molecular Formula | C12H8F4N2O |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-[(5-fluoro-2-pyridinyl)oxy]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(F)cn2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F4N2O/c13-7-1-4-11(18-6-7)19-10-3-2-8(17)5-9(10)12(14,15)16/h1-6H,17H2 |
| InChIKey | XSCMYKUBPXFOLL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|