C26H10F14N2O2 — CID 54530043
4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-3-(trifluoromethyl)aniline (PubChem CID 54530043) has the molecular formula C26H10F14N2O2 and a molecular weight of 648.35 g/mol. Its IUPAC name is 4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-3-(trifluoromethyl)aniline.
| Compound Name | 4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 54530043 |
| Molecular Formula | C26H10F14N2O2 |
| Molecular Weight | 648.35 g/mol |
| Exact Mass | 648.05 |
| IUPAC Name | 4-[4-[4-[4-amino-2-(trifluoromethyl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]-3-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2c(F)c(F)c(-c3c(F)c(F)c(Oc4ccc(N)cc4C(F)(F)F)c(F)c3F)c(F)c2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H10F14N2O2/c27-15-13(16(28)20(32)23(19(15)31)43-11-3-1-7(41)5-9(11)25(35,36)37)14-17(29)21(33)24(22(34)18(14)30)44-12-4-2-8(42)6-10(12)26(38,39)40/h1-6H,41-42H2 |
| InChIKey | YVWGGDZQHVSWTN-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.35 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|