C14H12F3NO — CID 18616432
3-methyl-4-[2-(trifluoromethyl)phenoxy]aniline (PubChem CID 18616432) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-methyl-4-[2-(trifluoromethyl)phenoxy]aniline.
| Compound Name | 3-methyl-4-[2-(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 18616432 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-methyl-4-[2-(trifluoromethyl)phenoxy]aniline |
| SMILES | Cc1cc(N)ccc1Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO/c1-9-8-10(18)6-7-12(9)19-13-5-3-2-4-11(13)14(15,16)17/h2-8H,18H2,1H3 |
| InChIKey | OCKJODKZFFEPQZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|