C20H14F6N2OU — CID 162520552
4-(phenoxy)-3-(trifluoromethyl)aniline;3-(trifluoromethyl)benzene-4-id-1-amine;uranium(2+) (PubChem CID 162520552) has the molecular formula C20H14F6N2OU and a molecular weight of 650.36 g/mol. Its IUPAC name is 4-(phenoxy)-3-(trifluoromethyl)aniline;3-(trifluoromethyl)benzene-4-id-1-amine;uranium(2+).
| Compound Name | 4-(phenoxy)-3-(trifluoromethyl)aniline;3-(trifluoromethyl)benzene-4-id-1-amine;uranium(2+) |
|---|---|
| PubChem CID | 162520552 |
| Molecular Formula | C20H14F6N2OU |
| Molecular Weight | 650.36 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 4-(phenoxy)-3-(trifluoromethyl)aniline;3-(trifluoromethyl)benzene-4-id-1-amine;uranium(2+) |
| SMILES | Nc1cc[c-]c(C(F)(F)F)c1.Nc1ccc(Oc2cc[c-]cc2)c(C(F)(F)F)c1.[U+2] |
| InChI | InChI=1S/C13H9F3NO.C7H5F3N.U/c14-13(15,16)11-8-9(17)6-7-12(11)18-10-4-2-1-3-5-10;8-7(9,10)5-2-1-3-6(11)4-5;/h2-8H,17H2;1,3-4H,11H2;/q2*-1;+2 |
| InChIKey | ZVRCDVPVUQLEQT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|