C10H10ClF3O4 — CID 170818716
1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2,3-triol (PubChem CID 170818716) has the molecular formula C10H10ClF3O4 and a molecular weight of 286.63 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818716 |
| Molecular Formula | C10H10ClF3O4 |
| Molecular Weight | 286.63 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethoxy)phenyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(OC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H10ClF3O4/c11-7-3-5(18-10(12,13)14)1-2-6(7)9(17)8(16)4-15/h1-3,8-9,15-17H,4H2 |
| InChIKey | JPROPROQZCLYEU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |