C11H15F3N2O3 — CID 171858863
1-[2-amino-4-(trifluoromethoxy)phenyl]-3-(methylamino)propane-1,2-diol (PubChem CID 171858863) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171858863 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-3-(methylamino)propane-1,2-diol |
| SMILES | CNCC(O)C(O)c1ccc(OC(F)(F)F)cc1N |
| InChI | InChI=1S/C11H15F3N2O3/c1-16-5-9(17)10(18)7-3-2-6(4-8(7)15)19-11(12,13)14/h2-4,9-10,16-18H,5,15H2,1H3 |
| InChIKey | XRCOTRXGWTUMBW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|