C11H14F3NO3S — CID 171875016
1-[2-amino-5-(trifluoromethoxy)phenyl]-4-sulfanylbutane-1,2-diol (PubChem CID 171875016) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171875016 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-4-sulfanylbutane-1,2-diol |
| SMILES | Nc1ccc(OC(F)(F)F)cc1C(O)C(O)CCS |
| InChI | InChI=1S/C11H14F3NO3S/c12-11(13,14)18-6-1-2-8(15)7(5-6)10(17)9(16)3-4-19/h1-2,5,9-10,16-17,19H,3-4,15H2 |
| InChIKey | ABBAGXFOXFYMPV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|