C14H14F3NO3 — CID 106988154
2-[2-amino-5-(trifluoromethoxy)phenyl]hept-5-ynoic acid (PubChem CID 106988154) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-[2-amino-5-(trifluoromethoxy)phenyl]hept-5-ynoic acid.
| Compound Name | 2-[2-amino-5-(trifluoromethoxy)phenyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 106988154 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[2-amino-5-(trifluoromethoxy)phenyl]hept-5-ynoic acid |
| SMILES | CC#CCCC(C(=O)O)c1cc(OC(F)(F)F)ccc1N |
| InChI | InChI=1S/C14H14F3NO3/c1-2-3-4-5-10(13(19)20)11-8-9(6-7-12(11)18)21-14(15,16)17/h6-8,10H,4-5,18H2,1H3,(H,19,20) |
| InChIKey | NUYULJDRWHSWAC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|