C15H13F3N2O4 — CID 68662239
[2-amino-5-[3-(trifluoromethoxy)phenoxy]phenyl]methylcarbamic acid (PubChem CID 68662239) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is [2-amino-5-[3-(trifluoromethoxy)phenoxy]phenyl]methylcarbamic acid.
| Compound Name | [2-amino-5-[3-(trifluoromethoxy)phenoxy]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68662239 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [2-amino-5-[3-(trifluoromethoxy)phenoxy]phenyl]methylcarbamic acid |
| SMILES | Nc1ccc(Oc2cccc(OC(F)(F)F)c2)cc1CNC(=O)O |
| InChI | InChI=1S/C15H13F3N2O4/c16-15(17,18)24-12-3-1-2-10(7-12)23-11-4-5-13(19)9(6-11)8-20-14(21)22/h1-7,20H,8,19H2,(H,21,22) |
| InChIKey | JWGNRKUKVUKQHL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|